methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate

C16H16O5 — CID 58067095

IUPACmethyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate
SMILESCCc1coc(C(=O)OC)c(OCc2ccccc2)c1=O
InChIInChI=1S/C16H16O5/c1-3-12-10-21-15(16(18)19-2)14(13(12)17)20-9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3
InChIKeyWFQDHVCUNFFBAP-UHFFFAOYSA-N
MW288.30 g/mol
LogP2.57
Rot. Bonds5

About methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate

methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate (PubChem CID 58067095) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate
PubChem CID58067095
Molecular FormulaC16H16O5
Molecular Weight288.30 g/mol
Exact Mass288.10
IUPAC Namemethyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate
SMILESCCc1coc(C(=O)OC)c(OCc2ccccc2)c1=O
InChIInChI=1S/C16H16O5/c1-3-12-10-21-15(16(18)19-2)14(13(12)17)20-9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3
InChIKeyWFQDHVCUNFFBAP-UHFFFAOYSA-N
XLogP2.57
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 52.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The IUPAC name of methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate (CID 58067095) is methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate.
What is the SMILES notation for methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The canonical SMILES for methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate is CCc1coc(C(=O)OC)c(OCc2ccccc2)c1=O.
What is the InChIKey of methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The InChIKey is WFQDHVCUNFFBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O5/c1-3-12-10-21-15(16(18)19-2)14(13(12)17)20-9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3.
What are the key properties of methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate?
methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate has a molecular weight of 288.30 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-4-oxo-3-phenylmethoxypyran-2-carboxylate is sourced from PubChem (CID 58067095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).