C23H21F2NO6 — CID 155699761
1-(2,4-difluorophenyl)-N-methylmethanamine;methyl 5-formyl-4-oxo-3-phenylmethoxypyran-2-carboxylate (PubChem CID 155699761) has the molecular formula C23H21F2NO6 and a molecular weight of 445.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-methylmethanamine;methyl 5-formyl-4-oxo-3-phenylmethoxypyran-2-carboxylate.
| Compound Name | 1-(2,4-difluorophenyl)-N-methylmethanamine;methyl 5-formyl-4-oxo-3-phenylmethoxypyran-2-carboxylate |
|---|---|
| PubChem CID | 155699761 |
| Molecular Formula | C23H21F2NO6 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-methylmethanamine;methyl 5-formyl-4-oxo-3-phenylmethoxypyran-2-carboxylate |
| SMILES | CNCc1ccc(F)cc1F.COC(=O)c1occ(C=O)c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H12O6.C8H9F2N/c1-19-15(18)14-13(12(17)11(7-16)9-21-14)20-8-10-5-3-2-4-6-10;1-11-5-6-2-3-7(9)4-8(6)10/h2-7,9H,8H2,1H3;2-4,11H,5H2,1H3 |
| InChIKey | DSBBVLXQDQCENX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|