C25H19FO5 — CID 142666049
2-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-5-methyl-3-phenylmethoxypyran-4-one (PubChem CID 142666049) has the molecular formula C25H19FO5 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-5-methyl-3-phenylmethoxypyran-4-one.
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-5-methyl-3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 142666049 |
| Molecular Formula | C25H19FO5 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-5-methyl-3-phenylmethoxypyran-4-one |
| SMILES | Cc1coc(C(=O)c2ccc(Cc3ccc(F)cc3)o2)c(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C25H19FO5/c1-16-14-29-25(24(22(16)27)30-15-18-5-3-2-4-6-18)23(28)21-12-11-20(31-21)13-17-7-9-19(26)10-8-17/h2-12,14H,13,15H2,1H3 |
| InChIKey | LFJRCUVRXSNPIW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |