C22H19FO6 — CID 118247992
5-butoxy-6-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-oxopyran-2-carbaldehyde (PubChem CID 118247992) has the molecular formula C22H19FO6 and a molecular weight of 398.39 g/mol. Its IUPAC name is 5-butoxy-6-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-oxopyran-2-carbaldehyde.
| Compound Name | 5-butoxy-6-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-oxopyran-2-carbaldehyde |
|---|---|
| PubChem CID | 118247992 |
| Molecular Formula | C22H19FO6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-butoxy-6-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-oxopyran-2-carbaldehyde |
| SMILES | CCCCOc1c(C(=O)c2ccc(Cc3ccc(F)cc3)o2)oc(C=O)cc1=O |
| InChI | InChI=1S/C22H19FO6/c1-2-3-10-27-21-18(25)12-17(13-24)29-22(21)20(26)19-9-8-16(28-19)11-14-4-6-15(23)7-5-14/h4-9,12-13H,2-3,10-11H2,1H3 |
| InChIKey | ZUJBPTMLYFQHMU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|