C16H13FO5 — CID 22209624
methyl (Z)-4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 22209624) has the molecular formula C16H13FO5 and a molecular weight of 304.27 g/mol. Its IUPAC name is methyl (Z)-4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl (Z)-4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 22209624 |
| Molecular Formula | C16H13FO5 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl (Z)-4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)/C=C(\O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H13FO5/c1-21-16(20)14(19)9-13(18)15-7-6-12(22-15)8-10-2-4-11(17)5-3-10/h2-7,9,18H,8H2,1H3/b13-9- |
| InChIKey | XYLMZMHZRUNQTE-LCYFTJDESA-N |
| XLogP | 2.65 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|