C15H11FO5 — CID 91404110
4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxobutanoic acid (PubChem CID 91404110) has the molecular formula C15H11FO5 and a molecular weight of 290.25 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 91404110 |
| Molecular Formula | C15H11FO5 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H11FO5/c16-10-3-1-9(2-4-10)7-11-5-6-14(21-11)12(17)8-13(18)15(19)20/h1-6H,7-8H2,(H,19,20) |
| InChIKey | PDZPHBYBTBEMQC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|