C17H12FNO4 — CID 68555967
3-[5-[(4-fluorophenyl)methyl]furan-2-yl]-1-(1,2-oxazol-3-yl)propane-1,2-dione (PubChem CID 68555967) has the molecular formula C17H12FNO4 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-[5-[(4-fluorophenyl)methyl]furan-2-yl]-1-(1,2-oxazol-3-yl)propane-1,2-dione.
| Compound Name | 3-[5-[(4-fluorophenyl)methyl]furan-2-yl]-1-(1,2-oxazol-3-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 68555967 |
| Molecular Formula | C17H12FNO4 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-[5-[(4-fluorophenyl)methyl]furan-2-yl]-1-(1,2-oxazol-3-yl)propane-1,2-dione |
| SMILES | O=C(Cc1ccc(Cc2ccc(F)cc2)o1)C(=O)c1ccon1 |
| InChI | InChI=1S/C17H12FNO4/c18-12-3-1-11(2-4-12)9-13-5-6-14(23-13)10-16(20)17(21)15-7-8-22-19-15/h1-8H,9-10H2 |
| InChIKey | FMPZSMYKSYQLNZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|