C24H18FNO5S — CID 69137739
1-[1-(benzenesulfonyl)pyrrol-2-yl]-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propane-1,2-dione (PubChem CID 69137739) has the molecular formula C24H18FNO5S and a molecular weight of 451.48 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)pyrrol-2-yl]-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propane-1,2-dione.
| Compound Name | 1-[1-(benzenesulfonyl)pyrrol-2-yl]-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 69137739 |
| Molecular Formula | C24H18FNO5S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 1-[1-(benzenesulfonyl)pyrrol-2-yl]-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propane-1,2-dione |
| SMILES | O=C(Cc1ccc(Cc2ccc(F)cc2)o1)C(=O)c1cccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18FNO5S/c25-18-10-8-17(9-11-18)15-19-12-13-20(31-19)16-23(27)24(28)22-7-4-14-26(22)32(29,30)21-5-2-1-3-6-21/h1-14H,15-16H2 |
| InChIKey | DNXMLIWVNRFYBC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|