C17H13FN4O4 — CID 91188078
4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxo-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 91188078) has the molecular formula C17H13FN4O4 and a molecular weight of 356.31 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxo-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxo-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 91188078 |
| Molecular Formula | C17H13FN4O4 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2,4-dioxo-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | O=C(CC(=O)c1ccc(Cc2ccc(F)cc2)o1)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C17H13FN4O4/c18-11-3-1-10(2-4-11)7-12-5-6-15(26-12)13(23)8-14(24)16(25)21-17-19-9-20-22-17/h1-6,9H,7-8H2,(H2,19,20,21,22,25) |
| InChIKey | OWVNIJFLVZXIMJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|