C20H15FN2O4 — CID 69138597
4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2-hydroxy-4-oxo-N-pyridin-2-ylbut-2-enamide (PubChem CID 69138597) has the molecular formula C20H15FN2O4 and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2-hydroxy-4-oxo-N-pyridin-2-ylbut-2-enamide.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2-hydroxy-4-oxo-N-pyridin-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 69138597 |
| Molecular Formula | C20H15FN2O4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-yl]-2-hydroxy-4-oxo-N-pyridin-2-ylbut-2-enamide |
| SMILES | O=C(Nc1ccccn1)C(O)=CC(=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H15FN2O4/c21-14-6-4-13(5-7-14)11-15-8-9-18(27-15)16(24)12-17(25)20(26)23-19-3-1-2-10-22-19/h1-10,12,25H,11H2,(H,22,23,26) |
| InChIKey | ALQYOYQJZVCMKF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|