C15H12FNO4 — CID 118244664
(Z)-1-[5-[(4-fluorophenyl)methyl]-1,3-oxazol-2-yl]-3-hydroxypent-2-ene-1,4-dione (PubChem CID 118244664) has the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. Its IUPAC name is (Z)-1-[5-[(4-fluorophenyl)methyl]-1,3-oxazol-2-yl]-3-hydroxypent-2-ene-1,4-dione.
| Compound Name | (Z)-1-[5-[(4-fluorophenyl)methyl]-1,3-oxazol-2-yl]-3-hydroxypent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 118244664 |
| Molecular Formula | C15H12FNO4 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (Z)-1-[5-[(4-fluorophenyl)methyl]-1,3-oxazol-2-yl]-3-hydroxypent-2-ene-1,4-dione |
| SMILES | CC(=O)/C(O)=C/C(=O)c1ncc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H12FNO4/c1-9(18)13(19)7-14(20)15-17-8-12(21-15)6-10-2-4-11(16)5-3-10/h2-5,7-8,19H,6H2,1H3/b13-7- |
| InChIKey | ZIQCZJKKAJPFBH-QPEQYQDCSA-N |
| XLogP | 2.62 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|