C7H7N5O2 — CID 82344382
5-amino-N-(1H-1,2,4-triazol-5-yl)furan-2-carboxamide (PubChem CID 82344382) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 5-amino-N-(1H-1,2,4-triazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(1H-1,2,4-triazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82344382 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 5-amino-N-(1H-1,2,4-triazol-5-yl)furan-2-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2ncn[nH]2)o1 |
| InChI | InChI=1S/C7H7N5O2/c8-5-2-1-4(14-5)6(13)11-7-9-3-10-12-7/h1-3H,8H2,(H2,9,10,11,12,13) |
| InChIKey | LFYLELRLQFCQEL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |