C15H19N5O — CID 30865174
4-(piperidin-1-ylmethyl)-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 30865174) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(piperidin-1-ylmethyl)-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-(piperidin-1-ylmethyl)-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 30865174 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-(piperidin-1-ylmethyl)-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C15H19N5O/c21-14(18-15-16-11-17-19-15)13-6-4-12(5-7-13)10-20-8-2-1-3-9-20/h4-7,11H,1-3,8-10H2,(H2,16,17,18,19,21) |
| InChIKey | YJCACESDNHKJKH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |