C16H13BFNO4 — CID 90986043
CID 90986043 (PubChem CID 90986043) has the molecular formula C16H13BFNO4 and a molecular weight of 313.09 g/mol.
| Compound Name | CID 90986043 |
|---|---|
| PubChem CID | 90986043 |
| Molecular Formula | C16H13BFNO4 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | — |
| SMILES | [B]CNC(=O)C(=O)CC(=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H13BFNO4/c17-9-19-16(22)14(21)8-13(20)15-6-5-12(23-15)7-10-1-3-11(18)4-2-10/h1-6H,7-9H2,(H,19,22) |
| InChIKey | XQKSHPTZEYPPKP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|