C11H10FN5O2 — CID 108529871
N-[(4-fluorophenyl)methyl]-N'-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108529871) has the molecular formula C11H10FN5O2 and a molecular weight of 263.23 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108529871 |
| Molecular Formula | C11H10FN5O2 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C11H10FN5O2/c12-8-3-1-7(2-4-8)5-13-9(18)10(19)16-11-14-6-15-17-11/h1-4,6H,5H2,(H,13,18)(H2,14,15,16,17,19) |
| InChIKey | FXPFOCLIFRWVBB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|