C8H13N5O3 — CID 108529940
N'-(1-hydroxy-2-methylpropan-2-yl)-N-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108529940) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is N'-(1-hydroxy-2-methylpropan-2-yl)-N-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108529940 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | CC(C)(CO)NC(=O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C8H13N5O3/c1-8(2,3-14)12-6(16)5(15)11-7-9-4-10-13-7/h4,14H,3H2,1-2H3,(H,12,16)(H2,9,10,11,13,15) |
| InChIKey | ZUPGMWBOCZPSND-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|