C9H13N5O2 — CID 108506010
N-cyclopentyl-N'-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108506010) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is N-cyclopentyl-N'-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N-cyclopentyl-N'-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108506010 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-cyclopentyl-N'-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | O=C(Nc1ncn[nH]1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C9H13N5O2/c15-7(12-6-3-1-2-4-6)8(16)13-9-10-5-11-14-9/h5-6H,1-4H2,(H,12,15)(H2,10,11,13,14,16) |
| InChIKey | DCCSTPZTOABRCG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|