C9H10N4O2 — CID 44996583
N-cyclopropyl-N'-pyrimidin-2-yloxamide (PubChem CID 44996583) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is N-cyclopropyl-N'-pyrimidin-2-yloxamide.
| Compound Name | N-cyclopropyl-N'-pyrimidin-2-yloxamide |
|---|---|
| PubChem CID | 44996583 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-cyclopropyl-N'-pyrimidin-2-yloxamide |
| SMILES | O=C(Nc1ncccn1)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H10N4O2/c14-7(12-6-2-3-6)8(15)13-9-10-4-1-5-11-9/h1,4-6H,2-3H2,(H,12,14)(H,10,11,13,15) |
| InChIKey | AOKZQMRIOXCOJI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|