C17H24N2O4 — CID 154784991
N-[(4R,5S)-4,5-dihydroxycycloheptyl]-N'-(3,5-dimethylphenyl)oxamide (PubChem CID 154784991) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(4R,5S)-4,5-dihydroxycycloheptyl]-N'-(3,5-dimethylphenyl)oxamide.
| Compound Name | N-[(4R,5S)-4,5-dihydroxycycloheptyl]-N'-(3,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 154784991 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(4R,5S)-4,5-dihydroxycycloheptyl]-N'-(3,5-dimethylphenyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)NC2CC[C@@H](O)[C@@H](O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-10-7-11(2)9-13(8-10)19-17(23)16(22)18-12-3-5-14(20)15(21)6-4-12/h7-9,12,14-15,20-21H,3-6H2,1-2H3,(H,18,22)(H,19,23)/t12?,14-,15+ |
| InChIKey | YWUHMKDYXYEGJN-LQDVMPOASA-N |
| XLogP | 1.02 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|