C17H24N2O2 — CID 124505061
N-(4-ethylcyclohexyl)-N'-(3-methylphenyl)oxamide (PubChem CID 124505061) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-N'-(3-methylphenyl)oxamide.
| Compound Name | N-(4-ethylcyclohexyl)-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 124505061 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(4-ethylcyclohexyl)-N'-(3-methylphenyl)oxamide |
| SMILES | CCC1CCC(NC(=O)C(=O)Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-13-7-9-14(10-8-13)18-16(20)17(21)19-15-6-4-5-12(2)11-15/h4-6,11,13-14H,3,7-10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | OXQLNGFZXIFKLR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|