C14H17N5O2 — CID 75457948
N-cyclohexyl-N'-([1,2,4]triazolo[1,5-a]pyridin-2-yl)oxamide (PubChem CID 75457948) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-cyclohexyl-N'-([1,2,4]triazolo[1,5-a]pyridin-2-yl)oxamide.
| Compound Name | N-cyclohexyl-N'-([1,2,4]triazolo[1,5-a]pyridin-2-yl)oxamide |
|---|---|
| PubChem CID | 75457948 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-cyclohexyl-N'-([1,2,4]triazolo[1,5-a]pyridin-2-yl)oxamide |
| SMILES | O=C(Nc1nc2ccccn2n1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H17N5O2/c20-12(15-10-6-2-1-3-7-10)13(21)17-14-16-11-8-4-5-9-19(11)18-14/h4-5,8-10H,1-3,6-7H2,(H,15,20)(H,17,18,21) |
| InChIKey | ABYZQWDGZTUACW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|