C18H20N6O — CID 126766596
1-(1-phenylpiperidin-3-yl)-3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 126766596) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-(1-phenylpiperidin-3-yl)-3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-(1-phenylpiperidin-3-yl)-3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 126766596 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(1-phenylpiperidin-3-yl)-3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | O=C(Nc1nc2ccccn2n1)NC1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N6O/c25-18(21-17-20-16-10-4-5-12-24(16)22-17)19-14-7-6-11-23(13-14)15-8-2-1-3-9-15/h1-5,8-10,12,14H,6-7,11,13H2,(H2,19,21,22,25) |
| InChIKey | UXQAHHRMVOSBAK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |