C12H21N5O2 — CID 108526242
N-(1H-1,2,4-triazol-5-yl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108526242) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526242 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H21N5O2/c1-11(2,3)6-12(4,5)16-9(19)8(18)15-10-13-7-14-17-10/h7H,6H2,1-5H3,(H,16,19)(H2,13,14,15,17,18) |
| InChIKey | HSWXNGMOTRONBQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|