C16H23ClN2O2 — CID 108500305
N-(2-chlorophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108500305) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108500305 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(2-chlorophenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O2/c1-15(2,3)10-16(4,5)19-14(21)13(20)18-12-9-7-6-8-11(12)17/h6-9H,10H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | QOIQAJNLNYBNBF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|