C17H26ClNO2 — CID 108789472
3-(2-chlorophenoxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 108789472) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | 3-(2-chlorophenoxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 108789472 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CCOc1ccccc1Cl |
| InChI | InChI=1S/C17H26ClNO2/c1-16(2,3)12-17(4,5)19-15(20)10-11-21-14-9-7-6-8-13(14)18/h6-9H,10-12H2,1-5H3,(H,19,20) |
| InChIKey | GDAFPHBRPCUIPC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |