C17H25NO — CID 58159202
2-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide (PubChem CID 58159202) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide.
| Compound Name | 2-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58159202 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
| SMILES | C=C(C(=O)NC(C)(C)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-13(14-10-8-7-9-11-14)15(19)18-17(5,6)12-16(2,3)4/h7-11H,1,12H2,2-6H3,(H,18,19) |
| InChIKey | HCLLVUMYYKCEEZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|