C23H29NO — CID 94842470
(E)-2,3-diphenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide (PubChem CID 94842470) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (E)-2,3-diphenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide.
| Compound Name | (E)-2,3-diphenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 94842470 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (E)-2,3-diphenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO/c1-22(2,3)17-23(4,5)24-21(25)20(19-14-10-7-11-15-19)16-18-12-8-6-9-13-18/h6-16H,17H2,1-5H3,(H,24,25)/b20-16+ |
| InChIKey | LVXAYPOZNRVHFT-CAPFRKAQSA-N |
| XLogP | 5.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|