C7H8N4O3 — CID 82335526
(E)-3-methyl-4-oxo-4-(1H-1,2,4-triazol-5-ylamino)but-2-enoic acid (PubChem CID 82335526) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is (E)-3-methyl-4-oxo-4-(1H-1,2,4-triazol-5-ylamino)but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-oxo-4-(1H-1,2,4-triazol-5-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 82335526 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (E)-3-methyl-4-oxo-4-(1H-1,2,4-triazol-5-ylamino)but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H8N4O3/c1-4(2-5(12)13)6(14)10-7-8-3-9-11-7/h2-3H,1H3,(H,12,13)(H2,8,9,10,11,14)/b4-2+ |
| InChIKey | OESSRMDICLBPQU-DUXPYHPUSA-N |
| XLogP | -0.23 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|