C6H8N4O — CID 76981365
N-(1H-1,2,4-triazol-5-yl)but-2-enamide (PubChem CID 76981365) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)but-2-enamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)but-2-enamide |
|---|---|
| PubChem CID | 76981365 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)but-2-enamide |
| SMILES | CC=CC(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4O/c1-2-3-5(11)9-6-7-4-8-10-6/h2-4H,1H3,(H2,7,8,9,10,11) |
| InChIKey | ASSCECZBGMEJHV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|