C4H8N6 — CID 146336368
2-methyl-1-(1H-1,2,4-triazol-5-yl)guanidine (PubChem CID 146336368) has the molecular formula C4H8N6 and a molecular weight of 140.15 g/mol. Its IUPAC name is 2-methyl-1-(1H-1,2,4-triazol-5-yl)guanidine.
| Compound Name | 2-methyl-1-(1H-1,2,4-triazol-5-yl)guanidine |
|---|---|
| PubChem CID | 146336368 |
| Molecular Formula | C4H8N6 |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-methyl-1-(1H-1,2,4-triazol-5-yl)guanidine |
| SMILES | C/N=C(\N)Nc1ncn[nH]1 |
| InChI | InChI=1S/C4H8N6/c1-6-3(5)9-4-7-2-8-10-4/h2H,1H3,(H4,5,6,7,8,9,10) |
| InChIKey | KBBJXBRAZCEHKP-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|