C9H15N5O2 — CID 30866586
(2R)-2-acetamido-3-methyl-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 30866586) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2R)-2-acetamido-3-methyl-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | (2R)-2-acetamido-3-methyl-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 30866586 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (2R)-2-acetamido-3-methyl-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | CC(=O)N[C@@H](C(=O)Nc1ncn[nH]1)C(C)C |
| InChI | InChI=1S/C9H15N5O2/c1-5(2)7(12-6(3)15)8(16)13-9-10-4-11-14-9/h4-5,7H,1-3H3,(H,12,15)(H2,10,11,13,14,16)/t7-/m1/s1 |
| InChIKey | MWCGKHNSHMSBSC-SSDOTTSWSA-N |
| XLogP | -0.10 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |