C11H12N6O2 — CID 110488934
(E)-3-(2-ethoxypyrimidin-5-yl)-N-(1H-1,2,4-triazol-5-yl)prop-2-enamide (PubChem CID 110488934) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is (E)-3-(2-ethoxypyrimidin-5-yl)-N-(1H-1,2,4-triazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-ethoxypyrimidin-5-yl)-N-(1H-1,2,4-triazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 110488934 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-3-(2-ethoxypyrimidin-5-yl)-N-(1H-1,2,4-triazol-5-yl)prop-2-enamide |
| SMILES | CCOc1ncc(/C=C/C(=O)Nc2ncn[nH]2)cn1 |
| InChI | InChI=1S/C11H12N6O2/c1-2-19-11-12-5-8(6-13-11)3-4-9(18)16-10-14-7-15-17-10/h3-7H,2H2,1H3,(H2,14,15,16,17,18)/b4-3+ |
| InChIKey | MYQJZPGLYVZJQU-ONEGZZNKSA-N |
| XLogP | 0.65 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|