C11H12ClFN2O2 — CID 108513981
N-(2-chloroethyl)-N'-[(4-fluorophenyl)methyl]oxamide (PubChem CID 108513981) has the molecular formula C11H12ClFN2O2 and a molecular weight of 258.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-N'-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N-(2-chloroethyl)-N'-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108513981 |
| Molecular Formula | C11H12ClFN2O2 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-chloroethyl)-N'-[(4-fluorophenyl)methyl]oxamide |
| SMILES | O=C(NCCCl)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12ClFN2O2/c12-5-6-14-10(16)11(17)15-7-8-1-3-9(13)4-2-8/h1-4H,5-7H2,(H,14,16)(H,15,17) |
| InChIKey | DLVIGBQYFRNSKV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|