C10H10ClFN2O2 — CID 43146267
2-chloro-N-[(4-fluorophenyl)methylcarbamoyl]acetamide (PubChem CID 43146267) has the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. Its IUPAC name is 2-chloro-N-[(4-fluorophenyl)methylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(4-fluorophenyl)methylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 43146267 |
| Molecular Formula | C10H10ClFN2O2 |
| Molecular Weight | 244.65 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-chloro-N-[(4-fluorophenyl)methylcarbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C10H10ClFN2O2/c11-5-9(15)14-10(16)13-6-7-1-3-8(12)4-2-7/h1-4H,5-6H2,(H2,13,14,15,16) |
| InChIKey | UCZRGWGOLZUQFT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|