C11H14ClFN2O3S — CID 146075739
2-chloro-N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]acetamide (PubChem CID 146075739) has the molecular formula C11H14ClFN2O3S and a molecular weight of 308.76 g/mol. Its IUPAC name is 2-chloro-N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]acetamide |
|---|---|
| PubChem CID | 146075739 |
| Molecular Formula | C11H14ClFN2O3S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-chloro-N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]acetamide |
| SMILES | O=C(CCl)NCCS(=O)(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14ClFN2O3S/c12-7-11(16)14-5-6-19(17,18)15-8-9-1-3-10(13)4-2-9/h1-4,15H,5-8H2,(H,14,16) |
| InChIKey | WEMCETVLHJIULK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|