C15H21FN2O4S — CID 94488951
N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]-2-[(2S)-oxolan-2-yl]acetamide (PubChem CID 94488951) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]-2-[(2S)-oxolan-2-yl]acetamide.
| Compound Name | N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]-2-[(2S)-oxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 94488951 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methylsulfamoyl]ethyl]-2-[(2S)-oxolan-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCCO1)NCCS(=O)(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O4S/c16-13-5-3-12(4-6-13)11-18-23(20,21)9-7-17-15(19)10-14-2-1-8-22-14/h3-6,14,18H,1-2,7-11H2,(H,17,19)/t14-/m0/s1 |
| InChIKey | ROENPKLZHAWUQP-AWEZNQCLSA-N |
| XLogP | 0.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |