C16H19NO4 — CID 77057744
3-[4-[[[2-(oxolan-2-yl)acetyl]amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 77057744) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[4-[[[2-(oxolan-2-yl)acetyl]amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[[2-(oxolan-2-yl)acetyl]amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77057744 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[4-[[[2-(oxolan-2-yl)acetyl]amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CNC(=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C16H19NO4/c18-15(10-14-2-1-9-21-14)17-11-13-5-3-12(4-6-13)7-8-16(19)20/h3-8,14H,1-2,9-11H2,(H,17,18)(H,19,20) |
| InChIKey | AVLHGKFHTAHGPR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|