C16H21ClN2O3 — CID 110625410
N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(oxan-2-yl)acetamide (PubChem CID 110625410) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(oxan-2-yl)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(oxan-2-yl)acetamide |
|---|---|
| PubChem CID | 110625410 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(oxan-2-yl)acetamide |
| SMILES | O=C(CNC(=O)CC1CCCCO1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN2O3/c17-13-6-4-12(5-7-13)10-18-16(21)11-19-15(20)9-14-3-1-2-8-22-14/h4-7,14H,1-3,8-11H2,(H,18,21)(H,19,20) |
| InChIKey | REVYASHWTFBFTM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |