C17H20ClN3O3S — CID 135849441
N-[(4-chlorophenyl)methyl]-2-[(5R)-4-oxo-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135849441) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(5R)-4-oxo-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(5R)-4-oxo-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135849441 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(5R)-4-oxo-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\C[C@H]2CCCO2)NC1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c18-12-5-3-11(4-6-12)9-19-15(22)8-14-16(23)21-17(25-14)20-10-13-2-1-7-24-13/h3-6,13-14H,1-2,7-10H2,(H,19,22)(H,20,21,23)/t13-,14-/m1/s1 |
| InChIKey | JIFUZRQIIZAZFB-ZIAGYGMSSA-N |
| XLogP | 2.11 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|