C16H17ClN4O5S — CID 135721760
N-(2-chloro-5-nitrophenyl)-2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135721760) has the molecular formula C16H17ClN4O5S and a molecular weight of 412.86 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135721760 |
| Molecular Formula | C16H17ClN4O5S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N/C[C@@H]2CCCO2)NC1=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H17ClN4O5S/c17-11-4-3-9(21(24)25)6-12(11)19-14(22)7-13-15(23)20-16(27-13)18-8-10-2-1-5-26-10/h3-4,6,10,13H,1-2,5,7-8H2,(H,19,22)(H,18,20,23)/t10-,13-/m0/s1 |
| InChIKey | NHRBZFLRUFKWKJ-GWCFXTLKSA-N |
| XLogP | 2.34 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|