C16H19N3O3S — CID 135673219
2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135673219) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135673219 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[(5S)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@@H]1S/C(=N/C[C@@H]2CCCO2)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H19N3O3S/c20-14(18-11-5-2-1-3-6-11)9-13-15(21)19-16(23-13)17-10-12-7-4-8-22-12/h1-3,5-6,12-13H,4,7-10H2,(H,18,20)(H,17,19,21)/t12-,13-/m0/s1 |
| InChIKey | KYQFBNRLPJCNLE-STQMWFEESA-N |
| XLogP | 1.78 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|