C16H18ClN3O3S — CID 135718712
N-(2-chlorophenyl)-2-[4-oxo-2-(oxolan-2-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135718712) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-oxo-2-(oxolan-2-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-oxo-2-(oxolan-2-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135718712 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-oxo-2-(oxolan-2-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N/CC2CCCO2)NC1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3S/c17-11-5-1-2-6-12(11)19-14(21)8-13-15(22)20-16(24-13)18-9-10-4-3-7-23-10/h1-2,5-6,10,13H,3-4,7-9H2,(H,19,21)(H,18,20,22) |
| InChIKey | KONTYCRNYKVDPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|