C18H23N3O3S — CID 135708434
2-[(5R)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide (PubChem CID 135708434) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(5R)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(5R)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 135708434 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[(5R)-4-oxo-2-[[(2S)-oxolan-2-yl]methylimino]-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\C[C@@H]2CCCO2)NC1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H23N3O3S/c22-16(19-9-8-13-5-2-1-3-6-13)11-15-17(23)21-18(25-15)20-12-14-7-4-10-24-14/h1-3,5-6,14-15H,4,7-12H2,(H,19,22)(H,20,21,23)/t14-,15+/m0/s1 |
| InChIKey | XXCBTFYWGKKZTM-LSDHHAIUSA-N |
| XLogP | 1.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|