C21H19N5O2S — CID 135906839
2-[(2Z,5R)-2-[(Z)-(4-cyanophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide (PubChem CID 135906839) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-(4-cyanophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-(4-cyanophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 135906839 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-(4-cyanophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
| SMILES | N#Cc1ccc(/C=N\N=C2\NC(=O)[C@@H](CC(=O)NCCc3ccccc3)S2)cc1 |
| InChI | InChI=1S/C21H19N5O2S/c22-13-16-6-8-17(9-7-16)14-24-26-21-25-20(28)18(29-21)12-19(27)23-11-10-15-4-2-1-3-5-15/h1-9,14,18H,10-12H2,(H,23,27)(H,25,26,28)/b24-14-/t18-/m1/s1 |
| InChIKey | OOKAZKFTMOXKAL-YNJLWJOVSA-N |
| XLogP | 2.23 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|