C26H32N6O2S — CID 172975338
N-[2-[4-(dimethylamino)phenyl]ethyl]-2-[4-oxo-2-[(E)-(4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 172975338) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]ethyl]-2-[4-oxo-2-[(E)-(4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-2-[4-oxo-2-[(E)-(4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 172975338 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-2-[4-oxo-2-[(E)-(4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CN(C)c1ccc(CCNC(=O)CC2SC(=N/N=C/c3ccc(N4CCCC4)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C26H32N6O2S/c1-31(2)21-9-5-19(6-10-21)13-14-27-24(33)17-23-25(34)29-26(35-23)30-28-18-20-7-11-22(12-8-20)32-15-3-4-16-32/h5-12,18,23H,3-4,13-17H2,1-2H3,(H,27,33)(H,29,30,34)/b28-18+ |
| InChIKey | MAIACBHMHYMRCG-MTDXEUNCSA-N |
| XLogP | 3.02 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|