C15H20N4O2S — CID 174087995
N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 174087995) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 174087995 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | [H]/N=C1\NC(=O)C(CC(=O)NCCc2ccc(N(C)C)cc2)S1 |
| InChI | InChI=1S/C15H20N4O2S/c1-19(2)11-5-3-10(4-6-11)7-8-17-13(20)9-12-14(21)18-15(16)22-12/h3-6,12H,7-9H2,1-2H3,(H,17,20)(H2,16,18,21) |
| InChIKey | GPKORTXVXCMVBC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|