C17H25FN4O3 — CID 27083840
2-[ethyl-[2-oxo-2-(propylcarbamoylamino)ethyl]amino]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 27083840) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[ethyl-[2-oxo-2-(propylcarbamoylamino)ethyl]amino]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[ethyl-[2-oxo-2-(propylcarbamoylamino)ethyl]amino]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27083840 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[ethyl-[2-oxo-2-(propylcarbamoylamino)ethyl]amino]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCCNC(=O)NC(=O)CN(CC)CC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FN4O3/c1-3-9-19-17(25)21-16(24)12-22(4-2)11-15(23)20-10-13-5-7-14(18)8-6-13/h5-8H,3-4,9-12H2,1-2H3,(H,20,23)(H2,19,21,24,25) |
| InChIKey | QERGGPKPQCCKJG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |