C19H21BrFN3O2 — CID 27201213
2-[[2-(4-bromoanilino)-2-oxoethyl]-ethylamino]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 27201213) has the molecular formula C19H21BrFN3O2 and a molecular weight of 422.30 g/mol. Its IUPAC name is 2-[[2-(4-bromoanilino)-2-oxoethyl]-ethylamino]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[[2-(4-bromoanilino)-2-oxoethyl]-ethylamino]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27201213 |
| Molecular Formula | C19H21BrFN3O2 |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-[[2-(4-bromoanilino)-2-oxoethyl]-ethylamino]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)CC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrFN3O2/c1-2-24(13-19(26)23-17-9-5-15(20)6-10-17)12-18(25)22-11-14-3-7-16(21)8-4-14/h3-10H,2,11-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | QQVJNHIVNBGXOP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |