C18H19ClFN3O2 — CID 9253245
N-[(4-chlorophenyl)methyl]-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 9253245) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9253245 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(Cl)cc1)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-23(12-18(25)22-16-8-6-15(20)7-9-16)11-17(24)21-10-13-2-4-14(19)5-3-13/h2-9H,10-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | WPYQISRHEADEIN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |