C19H20BrFN2O2 — CID 27821749
2-(4-bromophenyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]acetamide (PubChem CID 27821749) has the molecular formula C19H20BrFN2O2 and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 27821749 |
| Molecular Formula | C19H20BrFN2O2 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-(4-bromophenyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20BrFN2O2/c1-2-23(19(25)11-14-3-7-16(20)8-4-14)13-18(24)22-12-15-5-9-17(21)10-6-15/h3-10H,2,11-13H2,1H3,(H,22,24) |
| InChIKey | QYOIQEFPWBQIKZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |